C11H12Cl2N4OS — CID 79195689
N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-2-methyl-3-(methylamino)propanamide (PubChem CID 79195689) has the molecular formula C11H12Cl2N4OS and a molecular weight of 319.22 g/mol. Its IUPAC name is N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-2-methyl-3-(methylamino)propanamide.
| Compound Name | N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-2-methyl-3-(methylamino)propanamide |
|---|---|
| PubChem CID | 79195689 |
| Molecular Formula | C11H12Cl2N4OS |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-2-methyl-3-(methylamino)propanamide |
| SMILES | CNCC(C)C(=O)Nc1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C11H12Cl2N4OS/c1-5(4-14-2)11(18)15-8-6(12)3-7(13)9-10(8)17-19-16-9/h3,5,14H,4H2,1-2H3,(H,15,18) |
| InChIKey | MZHNICPCPMXXTF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |