C13H21N3O3S — CID 79195858
N-[4-(methanesulfonamido)-3-methylphenyl]-2-methyl-3-(methylamino)propanamide (PubChem CID 79195858) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is N-[4-(methanesulfonamido)-3-methylphenyl]-2-methyl-3-(methylamino)propanamide.
| Compound Name | N-[4-(methanesulfonamido)-3-methylphenyl]-2-methyl-3-(methylamino)propanamide |
|---|---|
| PubChem CID | 79195858 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-[4-(methanesulfonamido)-3-methylphenyl]-2-methyl-3-(methylamino)propanamide |
| SMILES | CNCC(C)C(=O)Nc1ccc(NS(C)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C13H21N3O3S/c1-9-7-11(15-13(17)10(2)8-14-3)5-6-12(9)16-20(4,18)19/h5-7,10,14,16H,8H2,1-4H3,(H,15,17) |
| InChIKey | JQOIQNFCBNKFJW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |