About 1-(3,5-dimethylphenyl)-2-methoxy-N,2-dimethylpropan-1-amine
1-(3,5-dimethylphenyl)-2-methoxy-N,2-dimethylpropan-1-amine (PubChem CID 79197545) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-methoxy-N,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 1-(3,5-dimethylphenyl)-2-methoxy-N,2-dimethylpropan-1-amine |
| PubChem CID | 79197545 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-methoxy-N,2-dimethylpropan-1-amine |
| SMILES | CNC(c1cc(C)cc(C)c1)C(C)(C)OC |
| InChI | InChI=1S/C14H23NO/c1-10-7-11(2)9-12(8-10)13(15-5)14(3,4)16-6/h7-9,13,15H,1-6H3 |
| InChIKey | CAYWZYAUTBEOBY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,5-dimethylphenyl)-2-methoxy-N,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dimethylphenyl)-2-methoxy-N,2-dimethylpropan-1-amine?
The IUPAC name of 1-(3,5-dimethylphenyl)-2-methoxy-N,2-dimethylpropan-1-amine (CID 79197545) is 1-(3,5-dimethylphenyl)-2-methoxy-N,2-dimethylpropan-1-amine.
What is the SMILES notation for 1-(3,5-dimethylphenyl)-2-methoxy-N,2-dimethylpropan-1-amine?
The canonical SMILES for 1-(3,5-dimethylphenyl)-2-methoxy-N,2-dimethylpropan-1-amine is CNC(c1cc(C)cc(C)c1)C(C)(C)OC.
What is the InChIKey of 1-(3,5-dimethylphenyl)-2-methoxy-N,2-dimethylpropan-1-amine?
The InChIKey is CAYWZYAUTBEOBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO/c1-10-7-11(2)9-12(8-10)13(15-5)14(3,4)16-6/h7-9,13,15H,1-6H3.
What are the key properties of 1-(3,5-dimethylphenyl)-2-methoxy-N,2-dimethylpropan-1-amine?
1-(3,5-dimethylphenyl)-2-methoxy-N,2-dimethylpropan-1-amine has a molecular weight of 221.34 g/mol, XLogP of 2.99, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethylphenyl)-2-methoxy-N,2-dimethylpropan-1-amine is sourced from PubChem (CID 79197545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).