About 5-hydroxy-N,N-bis(prop-2-enyl)pentanamide
5-hydroxy-N,N-bis(prop-2-enyl)pentanamide (PubChem CID 79198719) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 5-hydroxy-N,N-bis(prop-2-enyl)pentanamide.
Molecular Properties
| Compound Name | 5-hydroxy-N,N-bis(prop-2-enyl)pentanamide |
| PubChem CID | 79198719 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 5-hydroxy-N,N-bis(prop-2-enyl)pentanamide |
| SMILES | C=CCN(CC=C)C(=O)CCCCO |
| InChI | InChI=1S/C11H19NO2/c1-3-8-12(9-4-2)11(14)7-5-6-10-13/h3-4,13H,1-2,5-10H2 |
| InChIKey | QKOYRTWJJDUQOX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-N,N-bis(prop-2-enyl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-N,N-bis(prop-2-enyl)pentanamide?
The IUPAC name of 5-hydroxy-N,N-bis(prop-2-enyl)pentanamide (CID 79198719) is 5-hydroxy-N,N-bis(prop-2-enyl)pentanamide.
What is the SMILES notation for 5-hydroxy-N,N-bis(prop-2-enyl)pentanamide?
The canonical SMILES for 5-hydroxy-N,N-bis(prop-2-enyl)pentanamide is C=CCN(CC=C)C(=O)CCCCO.
What is the InChIKey of 5-hydroxy-N,N-bis(prop-2-enyl)pentanamide?
The InChIKey is QKOYRTWJJDUQOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-3-8-12(9-4-2)11(14)7-5-6-10-13/h3-4,13H,1-2,5-10H2.
What are the key properties of 5-hydroxy-N,N-bis(prop-2-enyl)pentanamide?
5-hydroxy-N,N-bis(prop-2-enyl)pentanamide has a molecular weight of 197.28 g/mol, XLogP of 1.35, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-N,N-bis(prop-2-enyl)pentanamide is sourced from PubChem (CID 79198719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).