About 3-(5-propyl-1H-1,2,4-triazol-3-yl)propan-1-ol
3-(5-propyl-1H-1,2,4-triazol-3-yl)propan-1-ol (PubChem CID 79200093) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is 3-(5-propyl-1H-1,2,4-triazol-3-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(5-propyl-1H-1,2,4-triazol-3-yl)propan-1-ol |
| PubChem CID | 79200093 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 3-(5-propyl-1H-1,2,4-triazol-3-yl)propan-1-ol |
| SMILES | CCCc1nc(CCCO)n[nH]1 |
| InChI | InChI=1S/C8H15N3O/c1-2-4-7-9-8(11-10-7)5-3-6-12/h12H,2-6H2,1H3,(H,9,10,11) |
| InChIKey | AJXOBSJXRZOEAT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5-propyl-1H-1,2,4-triazol-3-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-propyl-1H-1,2,4-triazol-3-yl)propan-1-ol?
The IUPAC name of 3-(5-propyl-1H-1,2,4-triazol-3-yl)propan-1-ol (CID 79200093) is 3-(5-propyl-1H-1,2,4-triazol-3-yl)propan-1-ol.
What is the SMILES notation for 3-(5-propyl-1H-1,2,4-triazol-3-yl)propan-1-ol?
The canonical SMILES for 3-(5-propyl-1H-1,2,4-triazol-3-yl)propan-1-ol is CCCc1nc(CCCO)n[nH]1.
What is the InChIKey of 3-(5-propyl-1H-1,2,4-triazol-3-yl)propan-1-ol?
The InChIKey is AJXOBSJXRZOEAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O/c1-2-4-7-9-8(11-10-7)5-3-6-12/h12H,2-6H2,1H3,(H,9,10,11).
What are the key properties of 3-(5-propyl-1H-1,2,4-triazol-3-yl)propan-1-ol?
3-(5-propyl-1H-1,2,4-triazol-3-yl)propan-1-ol has a molecular weight of 169.23 g/mol, XLogP of 0.68, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-propyl-1H-1,2,4-triazol-3-yl)propan-1-ol is sourced from PubChem (CID 79200093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).