C13H24N2O3 — CID 79200487
1-(4-hydroxypentanoyl)-N,N-dimethylpiperidine-4-carboxamide (PubChem CID 79200487) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-(4-hydroxypentanoyl)-N,N-dimethylpiperidine-4-carboxamide.
| Compound Name | 1-(4-hydroxypentanoyl)-N,N-dimethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 79200487 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1-(4-hydroxypentanoyl)-N,N-dimethylpiperidine-4-carboxamide |
| SMILES | CC(O)CCC(=O)N1CCC(C(=O)N(C)C)CC1 |
| InChI | InChI=1S/C13H24N2O3/c1-10(16)4-5-12(17)15-8-6-11(7-9-15)13(18)14(2)3/h10-11,16H,4-9H2,1-3H3 |
| InChIKey | NEROZHNFDSDWMO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |