About 4-hydroxy-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]butanamide
4-hydroxy-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]butanamide (PubChem CID 79203887) has the molecular formula C12H20F3NO3
and a molecular weight of 283.29 g/mol. Its IUPAC name is 4-hydroxy-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]butanamide.
Molecular Properties
| Compound Name | 4-hydroxy-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]butanamide |
| PubChem CID | 79203887 |
| Molecular Formula | C12H20F3NO3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 4-hydroxy-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]butanamide |
| SMILES | O=C(CCCO)NC1CCCC(OCC(F)(F)F)C1 |
| InChI | InChI=1S/C12H20F3NO3/c13-12(14,15)8-19-10-4-1-3-9(7-10)16-11(18)5-2-6-17/h9-10,17H,1-8H2,(H,16,18) |
| InChIKey | LIQGADWFNLOMPZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-hydroxy-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]butanamide?
The IUPAC name of 4-hydroxy-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]butanamide (CID 79203887) is 4-hydroxy-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]butanamide.
What is the SMILES notation for 4-hydroxy-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]butanamide?
The canonical SMILES for 4-hydroxy-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]butanamide is O=C(CCCO)NC1CCCC(OCC(F)(F)F)C1.
What is the InChIKey of 4-hydroxy-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]butanamide?
The InChIKey is LIQGADWFNLOMPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3NO3/c13-12(14,15)8-19-10-4-1-3-9(7-10)16-11(18)5-2-6-17/h9-10,17H,1-8H2,(H,16,18).
What are the key properties of 4-hydroxy-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]butanamide?
4-hydroxy-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]butanamide has a molecular weight of 283.29 g/mol, XLogP of 1.77, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]butanamide is sourced from PubChem (CID 79203887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).