C15H18F3N3 — CID 79204319
N-[[3,5-dimethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]methyl]propan-2-amine (PubChem CID 79204319) has the molecular formula C15H18F3N3 and a molecular weight of 297.32 g/mol. Its IUPAC name is N-[[3,5-dimethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]methyl]propan-2-amine.
| Compound Name | N-[[3,5-dimethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 79204319 |
| Molecular Formula | C15H18F3N3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[[3,5-dimethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]methyl]propan-2-amine |
| SMILES | Cc1nn(-c2cc(F)c(F)c(F)c2)c(C)c1CNC(C)C |
| InChI | InChI=1S/C15H18F3N3/c1-8(2)19-7-12-9(3)20-21(10(12)4)11-5-13(16)15(18)14(17)6-11/h5-6,8,19H,7H2,1-4H3 |
| InChIKey | IULZZSRGEGAITL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|