About 3-cyclopentyl-1-(3,4,5-trifluorophenyl)pyrazole-4-carbaldehyde
3-cyclopentyl-1-(3,4,5-trifluorophenyl)pyrazole-4-carbaldehyde (PubChem CID 79204327) has the molecular formula C15H13F3N2O
and a molecular weight of 294.28 g/mol. Its IUPAC name is 3-cyclopentyl-1-(3,4,5-trifluorophenyl)pyrazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 3-cyclopentyl-1-(3,4,5-trifluorophenyl)pyrazole-4-carbaldehyde |
| PubChem CID | 79204327 |
| Molecular Formula | C15H13F3N2O |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 3-cyclopentyl-1-(3,4,5-trifluorophenyl)pyrazole-4-carbaldehyde |
| SMILES | O=Cc1cn(-c2cc(F)c(F)c(F)c2)nc1C1CCCC1 |
| InChI | InChI=1S/C15H13F3N2O/c16-12-5-11(6-13(17)14(12)18)20-7-10(8-21)15(19-20)9-3-1-2-4-9/h5-9H,1-4H2 |
| InChIKey | BBPOSMFQHCWNRN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopentyl-1-(3,4,5-trifluorophenyl)pyrazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentyl-1-(3,4,5-trifluorophenyl)pyrazole-4-carbaldehyde?
The IUPAC name of 3-cyclopentyl-1-(3,4,5-trifluorophenyl)pyrazole-4-carbaldehyde (CID 79204327) is 3-cyclopentyl-1-(3,4,5-trifluorophenyl)pyrazole-4-carbaldehyde.
What is the SMILES notation for 3-cyclopentyl-1-(3,4,5-trifluorophenyl)pyrazole-4-carbaldehyde?
The canonical SMILES for 3-cyclopentyl-1-(3,4,5-trifluorophenyl)pyrazole-4-carbaldehyde is O=Cc1cn(-c2cc(F)c(F)c(F)c2)nc1C1CCCC1.
What is the InChIKey of 3-cyclopentyl-1-(3,4,5-trifluorophenyl)pyrazole-4-carbaldehyde?
The InChIKey is BBPOSMFQHCWNRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F3N2O/c16-12-5-11(6-13(17)14(12)18)20-7-10(8-21)15(19-20)9-3-1-2-4-9/h5-9H,1-4H2.
What are the key properties of 3-cyclopentyl-1-(3,4,5-trifluorophenyl)pyrazole-4-carbaldehyde?
3-cyclopentyl-1-(3,4,5-trifluorophenyl)pyrazole-4-carbaldehyde has a molecular weight of 294.28 g/mol, XLogP of 3.76, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyl-1-(3,4,5-trifluorophenyl)pyrazole-4-carbaldehyde is sourced from PubChem (CID 79204327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).