C14H7F3N2OS — CID 79204445
3-thiophen-2-yl-1-(3,4,5-trifluorophenyl)pyrazole-4-carbaldehyde (PubChem CID 79204445) has the molecular formula C14H7F3N2OS and a molecular weight of 308.28 g/mol. Its IUPAC name is 3-thiophen-2-yl-1-(3,4,5-trifluorophenyl)pyrazole-4-carbaldehyde.
| Compound Name | 3-thiophen-2-yl-1-(3,4,5-trifluorophenyl)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 79204445 |
| Molecular Formula | C14H7F3N2OS |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 3-thiophen-2-yl-1-(3,4,5-trifluorophenyl)pyrazole-4-carbaldehyde |
| SMILES | O=Cc1cn(-c2cc(F)c(F)c(F)c2)nc1-c1cccs1 |
| InChI | InChI=1S/C14H7F3N2OS/c15-10-4-9(5-11(16)13(10)17)19-6-8(7-20)14(18-19)12-2-1-3-21-12/h1-7H |
| InChIKey | XVIKCEJEKYJKGD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|