C25H21N3O3 — CID 7920471
methyl 3-[(1,3-diphenylpyrazole-5-carbonyl)amino]-4-methylbenzoate (PubChem CID 7920471) has the molecular formula C25H21N3O3 and a molecular weight of 411.46 g/mol. Its IUPAC name is methyl 3-[(1,3-diphenylpyrazole-5-carbonyl)amino]-4-methylbenzoate.
| Compound Name | methyl 3-[(1,3-diphenylpyrazole-5-carbonyl)amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 7920471 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | methyl 3-[(1,3-diphenylpyrazole-5-carbonyl)amino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)c2cc(-c3ccccc3)nn2-c2ccccc2)c1 |
| InChI | InChI=1S/C25H21N3O3/c1-17-13-14-19(25(30)31-2)15-21(17)26-24(29)23-16-22(18-9-5-3-6-10-18)27-28(23)20-11-7-4-8-12-20/h3-16H,1-2H3,(H,26,29) |
| InChIKey | PECCQHFIVRNNKJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |