About 3-[2,3-dihydro-1-benzothiophen-3-ylmethyl(2-methylpropyl)amino]-N'-hydroxypropanimidamide
3-[2,3-dihydro-1-benzothiophen-3-ylmethyl(2-methylpropyl)amino]-N'-hydroxypropanimidamide (PubChem CID 79205593) has the molecular formula C16H25N3OS
and a molecular weight of 307.46 g/mol. Its IUPAC name is 3-[2,3-dihydro-1-benzothiophen-3-ylmethyl(2-methylpropyl)amino]-N'-hydroxypropanimidamide.
Molecular Properties
| Compound Name | 3-[2,3-dihydro-1-benzothiophen-3-ylmethyl(2-methylpropyl)amino]-N'-hydroxypropanimidamide |
| PubChem CID | 79205593 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 3-[2,3-dihydro-1-benzothiophen-3-ylmethyl(2-methylpropyl)amino]-N'-hydroxypropanimidamide |
| SMILES | CC(C)CN(CCC(N)=NO)CC1CSc2ccccc21 |
| InChI | InChI=1S/C16H25N3OS/c1-12(2)9-19(8-7-16(17)18-20)10-13-11-21-15-6-4-3-5-14(13)15/h3-6,12-13,20H,7-11H2,1-2H3,(H2,17,18) |
| InChIKey | HKUDHBNFPHDDKK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,3-dihydro-1-benzothiophen-3-ylmethyl(2-methylpropyl)amino]-N'-hydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,3-dihydro-1-benzothiophen-3-ylmethyl(2-methylpropyl)amino]-N'-hydroxypropanimidamide?
The IUPAC name of 3-[2,3-dihydro-1-benzothiophen-3-ylmethyl(2-methylpropyl)amino]-N'-hydroxypropanimidamide (CID 79205593) is 3-[2,3-dihydro-1-benzothiophen-3-ylmethyl(2-methylpropyl)amino]-N'-hydroxypropanimidamide.
What is the SMILES notation for 3-[2,3-dihydro-1-benzothiophen-3-ylmethyl(2-methylpropyl)amino]-N'-hydroxypropanimidamide?
The canonical SMILES for 3-[2,3-dihydro-1-benzothiophen-3-ylmethyl(2-methylpropyl)amino]-N'-hydroxypropanimidamide is CC(C)CN(CCC(N)=NO)CC1CSc2ccccc21.
What is the InChIKey of 3-[2,3-dihydro-1-benzothiophen-3-ylmethyl(2-methylpropyl)amino]-N'-hydroxypropanimidamide?
The InChIKey is HKUDHBNFPHDDKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3OS/c1-12(2)9-19(8-7-16(17)18-20)10-13-11-21-15-6-4-3-5-14(13)15/h3-6,12-13,20H,7-11H2,1-2H3,(H2,17,18).
What are the key properties of 3-[2,3-dihydro-1-benzothiophen-3-ylmethyl(2-methylpropyl)amino]-N'-hydroxypropanimidamide?
3-[2,3-dihydro-1-benzothiophen-3-ylmethyl(2-methylpropyl)amino]-N'-hydroxypropanimidamide has a molecular weight of 307.46 g/mol, XLogP of 2.97, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,3-dihydro-1-benzothiophen-3-ylmethyl(2-methylpropyl)amino]-N'-hydroxypropanimidamide is sourced from PubChem (CID 79205593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).