C12H11ClN2S2 — CID 79206363
2-(1-chloroethyl)-5-(2,3-dihydro-1-benzothiophen-2-yl)-1,3,4-thiadiazole (PubChem CID 79206363) has the molecular formula C12H11ClN2S2 and a molecular weight of 282.82 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5-(2,3-dihydro-1-benzothiophen-2-yl)-1,3,4-thiadiazole.
| Compound Name | 2-(1-chloroethyl)-5-(2,3-dihydro-1-benzothiophen-2-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 79206363 |
| Molecular Formula | C12H11ClN2S2 |
| Molecular Weight | 282.82 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 2-(1-chloroethyl)-5-(2,3-dihydro-1-benzothiophen-2-yl)-1,3,4-thiadiazole |
| SMILES | CC(Cl)c1nnc(C2Cc3ccccc3S2)s1 |
| InChI | InChI=1S/C12H11ClN2S2/c1-7(13)11-14-15-12(17-11)10-6-8-4-2-3-5-9(8)16-10/h2-5,7,10H,6H2,1H3 |
| InChIKey | DFACIRLDHOYPIL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.82 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|