C11H17N3S — CID 79206994
4-[[(4-methyl-1,3-thiazol-5-yl)methylamino]methyl]cyclopent-2-en-1-amine (PubChem CID 79206994) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is 4-[[(4-methyl-1,3-thiazol-5-yl)methylamino]methyl]cyclopent-2-en-1-amine.
| Compound Name | 4-[[(4-methyl-1,3-thiazol-5-yl)methylamino]methyl]cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 79206994 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 4-[[(4-methyl-1,3-thiazol-5-yl)methylamino]methyl]cyclopent-2-en-1-amine |
| SMILES | Cc1ncsc1CNCC1C=CC(N)C1 |
| InChI | InChI=1S/C11H17N3S/c1-8-11(15-7-14-8)6-13-5-9-2-3-10(12)4-9/h2-3,7,9-10,13H,4-6,12H2,1H3 |
| InChIKey | QVNCCRUJIHBIHS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|