About 4-amino-N-(3,3,3-trifluoropropyl)cyclopent-2-ene-1-carboxamide
4-amino-N-(3,3,3-trifluoropropyl)cyclopent-2-ene-1-carboxamide (PubChem CID 79207052) has the molecular formula C9H13F3N2O
and a molecular weight of 222.21 g/mol. Its IUPAC name is 4-amino-N-(3,3,3-trifluoropropyl)cyclopent-2-ene-1-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N-(3,3,3-trifluoropropyl)cyclopent-2-ene-1-carboxamide |
| PubChem CID | 79207052 |
| Molecular Formula | C9H13F3N2O |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 4-amino-N-(3,3,3-trifluoropropyl)cyclopent-2-ene-1-carboxamide |
| SMILES | NC1C=CC(C(=O)NCCC(F)(F)F)C1 |
| InChI | InChI=1S/C9H13F3N2O/c10-9(11,12)3-4-14-8(15)6-1-2-7(13)5-6/h1-2,6-7H,3-5,13H2,(H,14,15) |
| InChIKey | CUZCMNRMBJGFQU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-(3,3,3-trifluoropropyl)cyclopent-2-ene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(3,3,3-trifluoropropyl)cyclopent-2-ene-1-carboxamide?
The IUPAC name of 4-amino-N-(3,3,3-trifluoropropyl)cyclopent-2-ene-1-carboxamide (CID 79207052) is 4-amino-N-(3,3,3-trifluoropropyl)cyclopent-2-ene-1-carboxamide.
What is the SMILES notation for 4-amino-N-(3,3,3-trifluoropropyl)cyclopent-2-ene-1-carboxamide?
The canonical SMILES for 4-amino-N-(3,3,3-trifluoropropyl)cyclopent-2-ene-1-carboxamide is NC1C=CC(C(=O)NCCC(F)(F)F)C1.
What is the InChIKey of 4-amino-N-(3,3,3-trifluoropropyl)cyclopent-2-ene-1-carboxamide?
The InChIKey is CUZCMNRMBJGFQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3N2O/c10-9(11,12)3-4-14-8(15)6-1-2-7(13)5-6/h1-2,6-7H,3-5,13H2,(H,14,15).
What are the key properties of 4-amino-N-(3,3,3-trifluoropropyl)cyclopent-2-ene-1-carboxamide?
4-amino-N-(3,3,3-trifluoropropyl)cyclopent-2-ene-1-carboxamide has a molecular weight of 222.21 g/mol, XLogP of 0.96, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(3,3,3-trifluoropropyl)cyclopent-2-ene-1-carboxamide is sourced from PubChem (CID 79207052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).