About 4-[[(2-methyl-1,3-thiazol-5-yl)methylamino]methyl]cyclopent-2-en-1-amine
4-[[(2-methyl-1,3-thiazol-5-yl)methylamino]methyl]cyclopent-2-en-1-amine (PubChem CID 79208325) has the molecular formula C11H17N3S
and a molecular weight of 223.34 g/mol. Its IUPAC name is 4-[[(2-methyl-1,3-thiazol-5-yl)methylamino]methyl]cyclopent-2-en-1-amine.
Molecular Properties
| Compound Name | 4-[[(2-methyl-1,3-thiazol-5-yl)methylamino]methyl]cyclopent-2-en-1-amine |
| PubChem CID | 79208325 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 4-[[(2-methyl-1,3-thiazol-5-yl)methylamino]methyl]cyclopent-2-en-1-amine |
| SMILES | Cc1ncc(CNCC2C=CC(N)C2)s1 |
| InChI | InChI=1S/C11H17N3S/c1-8-14-7-11(15-8)6-13-5-9-2-3-10(12)4-9/h2-3,7,9-10,13H,4-6,12H2,1H3 |
| InChIKey | VQYJSVCTCXQGJZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(2-methyl-1,3-thiazol-5-yl)methylamino]methyl]cyclopent-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2-methyl-1,3-thiazol-5-yl)methylamino]methyl]cyclopent-2-en-1-amine?
The IUPAC name of 4-[[(2-methyl-1,3-thiazol-5-yl)methylamino]methyl]cyclopent-2-en-1-amine (CID 79208325) is 4-[[(2-methyl-1,3-thiazol-5-yl)methylamino]methyl]cyclopent-2-en-1-amine.
What is the SMILES notation for 4-[[(2-methyl-1,3-thiazol-5-yl)methylamino]methyl]cyclopent-2-en-1-amine?
The canonical SMILES for 4-[[(2-methyl-1,3-thiazol-5-yl)methylamino]methyl]cyclopent-2-en-1-amine is Cc1ncc(CNCC2C=CC(N)C2)s1.
What is the InChIKey of 4-[[(2-methyl-1,3-thiazol-5-yl)methylamino]methyl]cyclopent-2-en-1-amine?
The InChIKey is VQYJSVCTCXQGJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3S/c1-8-14-7-11(15-8)6-13-5-9-2-3-10(12)4-9/h2-3,7,9-10,13H,4-6,12H2,1H3.
What are the key properties of 4-[[(2-methyl-1,3-thiazol-5-yl)methylamino]methyl]cyclopent-2-en-1-amine?
4-[[(2-methyl-1,3-thiazol-5-yl)methylamino]methyl]cyclopent-2-en-1-amine has a molecular weight of 223.34 g/mol, XLogP of 1.44, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2-methyl-1,3-thiazol-5-yl)methylamino]methyl]cyclopent-2-en-1-amine is sourced from PubChem (CID 79208325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).