About 4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid
4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 79209096) has the molecular formula C10H12N2O4S
and a molecular weight of 256.28 g/mol. Its IUPAC name is 4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid |
| PubChem CID | 79209096 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | O=C1NC(C(=O)NC2C=CC(C(=O)O)C2)CS1 |
| InChI | InChI=1S/C10H12N2O4S/c13-8(7-4-17-10(16)12-7)11-6-2-1-5(3-6)9(14)15/h1-2,5-7H,3-4H2,(H,11,13)(H,12,16)(H,14,15) |
| InChIKey | BYRYVTDOPWWZPU-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid?
The IUPAC name of 4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid (CID 79209096) is 4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid.
What is the SMILES notation for 4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid?
The canonical SMILES for 4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid is O=C1NC(C(=O)NC2C=CC(C(=O)O)C2)CS1.
What is the InChIKey of 4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid?
The InChIKey is BYRYVTDOPWWZPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O4S/c13-8(7-4-17-10(16)12-7)11-6-2-1-5(3-6)9(14)15/h1-2,5-7H,3-4H2,(H,11,13)(H,12,16)(H,14,15).
What are the key properties of 4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid?
4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid has a molecular weight of 256.28 g/mol, XLogP of -0.04, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid is sourced from PubChem (CID 79209096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).