C12H15N3O4 — CID 79210213
4-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoylamino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 79210213) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is 4-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoylamino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoylamino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 79210213 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 4-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoylamino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | Cc1noc(CCC(=O)NC2C=CC(C(=O)O)C2)n1 |
| InChI | InChI=1S/C12H15N3O4/c1-7-13-11(19-15-7)5-4-10(16)14-9-3-2-8(6-9)12(17)18/h2-3,8-9H,4-6H2,1H3,(H,14,16)(H,17,18) |
| InChIKey | SEBCZJFTUNJKFP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|