C12H11FN4O3 — CID 79210280
7-(6-fluoropyridine-3-carbonyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 79210280) has the molecular formula C12H11FN4O3 and a molecular weight of 278.24 g/mol. Its IUPAC name is 7-(6-fluoropyridine-3-carbonyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 7-(6-fluoropyridine-3-carbonyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 79210280 |
| Molecular Formula | C12H11FN4O3 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 7-(6-fluoropyridine-3-carbonyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(C(=O)c3ccc(F)nc3)C2)N1 |
| InChI | InChI=1S/C12H11FN4O3/c13-8-2-1-7(5-14-8)9(18)17-4-3-12(6-17)10(19)15-11(20)16-12/h1-2,5H,3-4,6H2,(H2,15,16,19,20) |
| InChIKey | CPXIJNPHZBCNKQ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|