About 4-(4-cyclopentyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine
4-(4-cyclopentyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine (PubChem CID 79210499) has the molecular formula C12H18N4
and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-(4-cyclopentyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine.
Molecular Properties
| Compound Name | 4-(4-cyclopentyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine |
| PubChem CID | 79210499 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 4-(4-cyclopentyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine |
| SMILES | NC1C=CC(c2nncn2C2CCCC2)C1 |
| InChI | InChI=1S/C12H18N4/c13-10-6-5-9(7-10)12-15-14-8-16(12)11-3-1-2-4-11/h5-6,8-11H,1-4,7,13H2 |
| InChIKey | RBWFWWWCATTZRF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-cyclopentyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-cyclopentyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine?
The IUPAC name of 4-(4-cyclopentyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine (CID 79210499) is 4-(4-cyclopentyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine.
What is the SMILES notation for 4-(4-cyclopentyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine?
The canonical SMILES for 4-(4-cyclopentyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine is NC1C=CC(c2nncn2C2CCCC2)C1.
What is the InChIKey of 4-(4-cyclopentyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine?
The InChIKey is RBWFWWWCATTZRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4/c13-10-6-5-9(7-10)12-15-14-8-16(12)11-3-1-2-4-11/h5-6,8-11H,1-4,7,13H2.
What are the key properties of 4-(4-cyclopentyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine?
4-(4-cyclopentyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine has a molecular weight of 218.30 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-cyclopentyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine is sourced from PubChem (CID 79210499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).