About 4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine
4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine (PubChem CID 79210736) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is 4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine.
Molecular Properties
| Compound Name | 4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine |
| PubChem CID | 79210736 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine |
| SMILES | Cc1nc(C2C=CC(N)C2)n[nH]1 |
| InChI | InChI=1S/C8H12N4/c1-5-10-8(12-11-5)6-2-3-7(9)4-6/h2-3,6-7H,4,9H2,1H3,(H,10,11,12) |
| InChIKey | OTEUBCRZVYRWPE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine?
The IUPAC name of 4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine (CID 79210736) is 4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine.
What is the SMILES notation for 4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine?
The canonical SMILES for 4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine is Cc1nc(C2C=CC(N)C2)n[nH]1.
What is the InChIKey of 4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine?
The InChIKey is OTEUBCRZVYRWPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4/c1-5-10-8(12-11-5)6-2-3-7(9)4-6/h2-3,6-7H,4,9H2,1H3,(H,10,11,12).
What are the key properties of 4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine?
4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine has a molecular weight of 164.21 g/mol, XLogP of 0.48, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine is sourced from PubChem (CID 79210736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).