About 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)cyclopent-2-en-1-amine
4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)cyclopent-2-en-1-amine (PubChem CID 79210902) has the molecular formula C10H16N4
and a molecular weight of 192.27 g/mol. Its IUPAC name is 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)cyclopent-2-en-1-amine.
Molecular Properties
| Compound Name | 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)cyclopent-2-en-1-amine |
| PubChem CID | 79210902 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)cyclopent-2-en-1-amine |
| SMILES | CC(C)c1n[nH]c(C2C=CC(N)C2)n1 |
| InChI | InChI=1S/C10H16N4/c1-6(2)9-12-10(14-13-9)7-3-4-8(11)5-7/h3-4,6-8H,5,11H2,1-2H3,(H,12,13,14) |
| InChIKey | MOXBDAQCBSJEKT-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)cyclopent-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)cyclopent-2-en-1-amine?
The IUPAC name of 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)cyclopent-2-en-1-amine (CID 79210902) is 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)cyclopent-2-en-1-amine.
What is the SMILES notation for 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)cyclopent-2-en-1-amine?
The canonical SMILES for 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)cyclopent-2-en-1-amine is CC(C)c1n[nH]c(C2C=CC(N)C2)n1.
What is the InChIKey of 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)cyclopent-2-en-1-amine?
The InChIKey is MOXBDAQCBSJEKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4/c1-6(2)9-12-10(14-13-9)7-3-4-8(11)5-7/h3-4,6-8H,5,11H2,1-2H3,(H,12,13,14).
What are the key properties of 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)cyclopent-2-en-1-amine?
4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)cyclopent-2-en-1-amine has a molecular weight of 192.27 g/mol, XLogP of 1.30, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)cyclopent-2-en-1-amine is sourced from PubChem (CID 79210902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).