C13H20F3N3O — CID 79210952
4-amino-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]cyclopent-2-ene-1-carboxamide (PubChem CID 79210952) has the molecular formula C13H20F3N3O and a molecular weight of 291.32 g/mol. Its IUPAC name is 4-amino-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]cyclopent-2-ene-1-carboxamide.
| Compound Name | 4-amino-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]cyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 79210952 |
| Molecular Formula | C13H20F3N3O |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 4-amino-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]cyclopent-2-ene-1-carboxamide |
| SMILES | NC1C=CC(C(=O)NCC2CCN(CC(F)(F)F)C2)C1 |
| InChI | InChI=1S/C13H20F3N3O/c14-13(15,16)8-19-4-3-9(7-19)6-18-12(20)10-1-2-11(17)5-10/h1-2,9-11H,3-8,17H2,(H,18,20) |
| InChIKey | UOZIWXIRHUDVNO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|