C11H18N4 — CID 79211139
4-(5-methyl-4-propyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine (PubChem CID 79211139) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 4-(5-methyl-4-propyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine.
| Compound Name | 4-(5-methyl-4-propyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 79211139 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 4-(5-methyl-4-propyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine |
| SMILES | CCCn1c(C)nnc1C1C=CC(N)C1 |
| InChI | InChI=1S/C11H18N4/c1-3-6-15-8(2)13-14-11(15)9-4-5-10(12)7-9/h4-5,9-10H,3,6-7,12H2,1-2H3 |
| InChIKey | PQIGMWWYIWASGA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|