About 2,6-dibromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-methylaniline
2,6-dibromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-methylaniline (PubChem CID 79213445) has the molecular formula C16H15Br2NS
and a molecular weight of 413.18 g/mol. Its IUPAC name is 2,6-dibromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-methylaniline.
Molecular Properties
| Compound Name | 2,6-dibromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-methylaniline |
| PubChem CID | 79213445 |
| Molecular Formula | C16H15Br2NS |
| Molecular Weight | 413.18 g/mol |
| Exact Mass | 410.93 |
| IUPAC Name | 2,6-dibromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-methylaniline |
| SMILES | Cc1cc(Br)c(NCC2Cc3ccccc3S2)c(Br)c1 |
| InChI | InChI=1S/C16H15Br2NS/c1-10-6-13(17)16(14(18)7-10)19-9-12-8-11-4-2-3-5-15(11)20-12/h2-7,12,19H,8-9H2,1H3 |
| InChIKey | SYCBMSFEEOUFNY-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.18 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dibromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-methylaniline?
The IUPAC name of 2,6-dibromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-methylaniline (CID 79213445) is 2,6-dibromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-methylaniline.
What is the SMILES notation for 2,6-dibromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-methylaniline?
The canonical SMILES for 2,6-dibromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-methylaniline is Cc1cc(Br)c(NCC2Cc3ccccc3S2)c(Br)c1.
What is the InChIKey of 2,6-dibromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-methylaniline?
The InChIKey is SYCBMSFEEOUFNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15Br2NS/c1-10-6-13(17)16(14(18)7-10)19-9-12-8-11-4-2-3-5-15(11)20-12/h2-7,12,19H,8-9H2,1H3.
What are the key properties of 2,6-dibromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-methylaniline?
2,6-dibromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-methylaniline has a molecular weight of 413.18 g/mol, XLogP of 5.65, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-methylaniline is sourced from PubChem (CID 79213445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).