C18H18O2S — CID 79214428
2-benzyl-3-(2,3-dihydro-1-benzothiophen-3-yl)propanoic acid (PubChem CID 79214428) has the molecular formula C18H18O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-benzyl-3-(2,3-dihydro-1-benzothiophen-3-yl)propanoic acid.
| Compound Name | 2-benzyl-3-(2,3-dihydro-1-benzothiophen-3-yl)propanoic acid |
|---|---|
| PubChem CID | 79214428 |
| Molecular Formula | C18H18O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-benzyl-3-(2,3-dihydro-1-benzothiophen-3-yl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)CC1CSc2ccccc21 |
| InChI | InChI=1S/C18H18O2S/c19-18(20)14(10-13-6-2-1-3-7-13)11-15-12-21-17-9-5-4-8-16(15)17/h1-9,14-15H,10-12H2,(H,19,20) |
| InChIKey | KWWZUJGSUXMDHE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |