2-benzyl-3-(2,3-dihydro-1-benzothiophen-3-yl)propanoic acid

C18H18O2S — CID 79214428

IUPAC2-benzyl-3-(2,3-dihydro-1-benzothiophen-3-yl)propanoic acid
SMILESO=C(O)C(Cc1ccccc1)CC1CSc2ccccc21
InChIInChI=1S/C18H18O2S/c19-18(20)14(10-13-6-2-1-3-7-13)11-15-12-21-17-9-5-4-8-16(15)17/h1-9,14-15H,10-12H2,(H,19,20)
InChIKeyKWWZUJGSUXMDHE-UHFFFAOYSA-N
MW298.41 g/mol
LogP4.21
Rot. Bonds5

About 2-benzyl-3-(2,3-dihydro-1-benzothiophen-3-yl)propanoic acid

2-benzyl-3-(2,3-dihydro-1-benzothiophen-3-yl)propanoic acid (PubChem CID 79214428) has the molecular formula C18H18O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-benzyl-3-(2,3-dihydro-1-benzothiophen-3-yl)propanoic acid.

Molecular Properties

Compound Name2-benzyl-3-(2,3-dihydro-1-benzothiophen-3-yl)propanoic acid
PubChem CID79214428
Molecular FormulaC18H18O2S
Molecular Weight298.41 g/mol
Exact Mass298.10
IUPAC Name2-benzyl-3-(2,3-dihydro-1-benzothiophen-3-yl)propanoic acid
SMILESO=C(O)C(Cc1ccccc1)CC1CSc2ccccc21
InChIInChI=1S/C18H18O2S/c19-18(20)14(10-13-6-2-1-3-7-13)11-15-12-21-17-9-5-4-8-16(15)17/h1-9,14-15H,10-12H2,(H,19,20)
InChIKeyKWWZUJGSUXMDHE-UHFFFAOYSA-N
XLogP4.21
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.41
LogP ≤ 54.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-benzyl-3-(2,3-dihydro-1-benzothiophen-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-benzyl-3-(2,3-dihydro-1-benzothiophen-3-yl)propanoic acid?
The IUPAC name of 2-benzyl-3-(2,3-dihydro-1-benzothiophen-3-yl)propanoic acid (CID 79214428) is 2-benzyl-3-(2,3-dihydro-1-benzothiophen-3-yl)propanoic acid.
What is the SMILES notation for 2-benzyl-3-(2,3-dihydro-1-benzothiophen-3-yl)propanoic acid?
The canonical SMILES for 2-benzyl-3-(2,3-dihydro-1-benzothiophen-3-yl)propanoic acid is O=C(O)C(Cc1ccccc1)CC1CSc2ccccc21.
What is the InChIKey of 2-benzyl-3-(2,3-dihydro-1-benzothiophen-3-yl)propanoic acid?
The InChIKey is KWWZUJGSUXMDHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O2S/c19-18(20)14(10-13-6-2-1-3-7-13)11-15-12-21-17-9-5-4-8-16(15)17/h1-9,14-15H,10-12H2,(H,19,20).
What are the key properties of 2-benzyl-3-(2,3-dihydro-1-benzothiophen-3-yl)propanoic acid?
2-benzyl-3-(2,3-dihydro-1-benzothiophen-3-yl)propanoic acid has a molecular weight of 298.41 g/mol, XLogP of 4.21, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-3-(2,3-dihydro-1-benzothiophen-3-yl)propanoic acid is sourced from PubChem (CID 79214428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).