C16H14N2OS2 — CID 79214560
2-(2,3-dihydro-1-benzothiophen-3-ylmethylsulfanyl)-1,3-benzoxazol-5-amine (PubChem CID 79214560) has the molecular formula C16H14N2OS2 and a molecular weight of 314.44 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzothiophen-3-ylmethylsulfanyl)-1,3-benzoxazol-5-amine.
| Compound Name | 2-(2,3-dihydro-1-benzothiophen-3-ylmethylsulfanyl)-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 79214560 |
| Molecular Formula | C16H14N2OS2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-(2,3-dihydro-1-benzothiophen-3-ylmethylsulfanyl)-1,3-benzoxazol-5-amine |
| SMILES | Nc1ccc2oc(SCC3CSc4ccccc43)nc2c1 |
| InChI | InChI=1S/C16H14N2OS2/c17-11-5-6-14-13(7-11)18-16(19-14)21-9-10-8-20-15-4-2-1-3-12(10)15/h1-7,10H,8-9,17H2 |
| InChIKey | WCOPQDDXJCFYCU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|