C23H30N2O3S — CID 7921552
(3R)-3-phenyl-1-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]butan-1-one (PubChem CID 7921552) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is (3R)-3-phenyl-1-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]butan-1-one.
| Compound Name | (3R)-3-phenyl-1-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 7921552 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (3R)-3-phenyl-1-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]butan-1-one |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCN(C(=O)C[C@@H](C)c3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C23H30N2O3S/c1-17-14-19(3)23(20(4)15-17)29(27,28)25-12-10-24(11-13-25)22(26)16-18(2)21-8-6-5-7-9-21/h5-9,14-15,18H,10-13,16H2,1-4H3/t18-/m1/s1 |
| InChIKey | KJYDEVBNLWPWKB-GOSISDBHSA-N |
| XLogP | 3.64 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |