C14H18N2OS2 — CID 79215741
N-(1-amino-1-sulfanylidenepentan-3-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide (PubChem CID 79215741) has the molecular formula C14H18N2OS2 and a molecular weight of 294.44 g/mol. Its IUPAC name is N-(1-amino-1-sulfanylidenepentan-3-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(1-amino-1-sulfanylidenepentan-3-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 79215741 |
| Molecular Formula | C14H18N2OS2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | N-(1-amino-1-sulfanylidenepentan-3-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide |
| SMILES | CCC(CC(N)=S)NC(=O)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C14H18N2OS2/c1-2-10(8-13(15)18)16-14(17)12-7-9-5-3-4-6-11(9)19-12/h3-6,10,12H,2,7-8H2,1H3,(H2,15,18)(H,16,17) |
| InChIKey | RSLHORFGKNSPDV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|