C10H11N5 — CID 79215915
4-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)cyclopent-2-en-1-amine (PubChem CID 79215915) has the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. Its IUPAC name is 4-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)cyclopent-2-en-1-amine.
| Compound Name | 4-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 79215915 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 4-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)cyclopent-2-en-1-amine |
| SMILES | NC1C=CC(c2nnc3ncccn23)C1 |
| InChI | InChI=1S/C10H11N5/c11-8-3-2-7(6-8)9-13-14-10-12-4-1-5-15(9)10/h1-5,7-8H,6,11H2 |
| InChIKey | JLXAEZWUSWZPBL-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|