C10H14N4 — CID 79216795
4-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)cyclopent-2-en-1-amine (PubChem CID 79216795) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 4-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)cyclopent-2-en-1-amine.
| Compound Name | 4-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 79216795 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 4-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)cyclopent-2-en-1-amine |
| SMILES | NC1C=CC(c2nnc3n2CCC3)C1 |
| InChI | InChI=1S/C10H14N4/c11-8-4-3-7(6-8)10-13-12-9-2-1-5-14(9)10/h3-4,7-8H,1-2,5-6,11H2 |
| InChIKey | YFHTYOGTLOUFST-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|