C14H15N3O2S — CID 79216837
4-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 79216837) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is 4-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 79216837 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | Cc1sc2ncnc(NC3C=CC(C(=O)O)C3)c2c1C |
| InChI | InChI=1S/C14H15N3O2S/c1-7-8(2)20-13-11(7)12(15-6-16-13)17-10-4-3-9(5-10)14(18)19/h3-4,6,9-10H,5H2,1-2H3,(H,18,19)(H,15,16,17) |
| InChIKey | AXZSITBAJCCULB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|