C10H11ClN4O3 — CID 79216895
4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 79216895) has the molecular formula C10H11ClN4O3 and a molecular weight of 270.68 g/mol. Its IUPAC name is 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 79216895 |
| Molecular Formula | C10H11ClN4O3 |
| Molecular Weight | 270.68 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | COc1nc(Cl)nc(NC2C=CC(C(=O)O)C2)n1 |
| InChI | InChI=1S/C10H11ClN4O3/c1-18-10-14-8(11)13-9(15-10)12-6-3-2-5(4-6)7(16)17/h2-3,5-6H,4H2,1H3,(H,16,17)(H,12,13,14,15) |
| InChIKey | FUUBWNPRQITPRB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.68 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|