About 2-(4,6-diethyl-2-phenylpyrimidin-5-yl)-N-ethylethanamine
2-(4,6-diethyl-2-phenylpyrimidin-5-yl)-N-ethylethanamine (PubChem CID 79218247) has the molecular formula C18H25N3
and a molecular weight of 283.42 g/mol. Its IUPAC name is 2-(4,6-diethyl-2-phenylpyrimidin-5-yl)-N-ethylethanamine.
Molecular Properties
| Compound Name | 2-(4,6-diethyl-2-phenylpyrimidin-5-yl)-N-ethylethanamine |
| PubChem CID | 79218247 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 2-(4,6-diethyl-2-phenylpyrimidin-5-yl)-N-ethylethanamine |
| SMILES | CCNCCc1c(CC)nc(-c2ccccc2)nc1CC |
| InChI | InChI=1S/C18H25N3/c1-4-16-15(12-13-19-6-3)17(5-2)21-18(20-16)14-10-8-7-9-11-14/h7-11,19H,4-6,12-13H2,1-3H3 |
| InChIKey | MPQITJKIJPSJDD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,6-diethyl-2-phenylpyrimidin-5-yl)-N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-diethyl-2-phenylpyrimidin-5-yl)-N-ethylethanamine?
The IUPAC name of 2-(4,6-diethyl-2-phenylpyrimidin-5-yl)-N-ethylethanamine (CID 79218247) is 2-(4,6-diethyl-2-phenylpyrimidin-5-yl)-N-ethylethanamine.
What is the SMILES notation for 2-(4,6-diethyl-2-phenylpyrimidin-5-yl)-N-ethylethanamine?
The canonical SMILES for 2-(4,6-diethyl-2-phenylpyrimidin-5-yl)-N-ethylethanamine is CCNCCc1c(CC)nc(-c2ccccc2)nc1CC.
What is the InChIKey of 2-(4,6-diethyl-2-phenylpyrimidin-5-yl)-N-ethylethanamine?
The InChIKey is MPQITJKIJPSJDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3/c1-4-16-15(12-13-19-6-3)17(5-2)21-18(20-16)14-10-8-7-9-11-14/h7-11,19H,4-6,12-13H2,1-3H3.
What are the key properties of 2-(4,6-diethyl-2-phenylpyrimidin-5-yl)-N-ethylethanamine?
2-(4,6-diethyl-2-phenylpyrimidin-5-yl)-N-ethylethanamine has a molecular weight of 283.42 g/mol, XLogP of 3.42, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-diethyl-2-phenylpyrimidin-5-yl)-N-ethylethanamine is sourced from PubChem (CID 79218247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).