About 4,6-diethyl-N,N-dimethyl-5-[2-(2-methylpropylamino)ethyl]pyrimidin-2-amine
4,6-diethyl-N,N-dimethyl-5-[2-(2-methylpropylamino)ethyl]pyrimidin-2-amine (PubChem CID 79218408) has the molecular formula C16H30N4
and a molecular weight of 278.44 g/mol. Its IUPAC name is 4,6-diethyl-N,N-dimethyl-5-[2-(2-methylpropylamino)ethyl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4,6-diethyl-N,N-dimethyl-5-[2-(2-methylpropylamino)ethyl]pyrimidin-2-amine |
| PubChem CID | 79218408 |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | 4,6-diethyl-N,N-dimethyl-5-[2-(2-methylpropylamino)ethyl]pyrimidin-2-amine |
| SMILES | CCc1nc(N(C)C)nc(CC)c1CCNCC(C)C |
| InChI | InChI=1S/C16H30N4/c1-7-14-13(9-10-17-11-12(3)4)15(8-2)19-16(18-14)20(5)6/h12,17H,7-11H2,1-6H3 |
| InChIKey | NBFPNJRZZJINNV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,6-diethyl-N,N-dimethyl-5-[2-(2-methylpropylamino)ethyl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-diethyl-N,N-dimethyl-5-[2-(2-methylpropylamino)ethyl]pyrimidin-2-amine?
The IUPAC name of 4,6-diethyl-N,N-dimethyl-5-[2-(2-methylpropylamino)ethyl]pyrimidin-2-amine (CID 79218408) is 4,6-diethyl-N,N-dimethyl-5-[2-(2-methylpropylamino)ethyl]pyrimidin-2-amine.
What is the SMILES notation for 4,6-diethyl-N,N-dimethyl-5-[2-(2-methylpropylamino)ethyl]pyrimidin-2-amine?
The canonical SMILES for 4,6-diethyl-N,N-dimethyl-5-[2-(2-methylpropylamino)ethyl]pyrimidin-2-amine is CCc1nc(N(C)C)nc(CC)c1CCNCC(C)C.
What is the InChIKey of 4,6-diethyl-N,N-dimethyl-5-[2-(2-methylpropylamino)ethyl]pyrimidin-2-amine?
The InChIKey is NBFPNJRZZJINNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N4/c1-7-14-13(9-10-17-11-12(3)4)15(8-2)19-16(18-14)20(5)6/h12,17H,7-11H2,1-6H3.
What are the key properties of 4,6-diethyl-N,N-dimethyl-5-[2-(2-methylpropylamino)ethyl]pyrimidin-2-amine?
4,6-diethyl-N,N-dimethyl-5-[2-(2-methylpropylamino)ethyl]pyrimidin-2-amine has a molecular weight of 278.44 g/mol, XLogP of 2.46, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-diethyl-N,N-dimethyl-5-[2-(2-methylpropylamino)ethyl]pyrimidin-2-amine is sourced from PubChem (CID 79218408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).