About 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-ethyl-2-methylpropan-1-amine
3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-ethyl-2-methylpropan-1-amine (PubChem CID 79219214) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-ethyl-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-ethyl-2-methylpropan-1-amine |
| PubChem CID | 79219214 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-ethyl-2-methylpropan-1-amine |
| SMILES | CCNCC(C)Cc1c(C)n[nH]c1C |
| InChI | InChI=1S/C11H21N3/c1-5-12-7-8(2)6-11-9(3)13-14-10(11)4/h8,12H,5-7H2,1-4H3,(H,13,14) |
| InChIKey | JQUSAVASMWHRKJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-ethyl-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-ethyl-2-methylpropan-1-amine?
The IUPAC name of 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-ethyl-2-methylpropan-1-amine (CID 79219214) is 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-ethyl-2-methylpropan-1-amine.
What is the SMILES notation for 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-ethyl-2-methylpropan-1-amine?
The canonical SMILES for 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-ethyl-2-methylpropan-1-amine is CCNCC(C)Cc1c(C)n[nH]c1C.
What is the InChIKey of 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-ethyl-2-methylpropan-1-amine?
The InChIKey is JQUSAVASMWHRKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3/c1-5-12-7-8(2)6-11-9(3)13-14-10(11)4/h8,12H,5-7H2,1-4H3,(H,13,14).
What are the key properties of 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-ethyl-2-methylpropan-1-amine?
3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-ethyl-2-methylpropan-1-amine has a molecular weight of 195.31 g/mol, XLogP of 1.81, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-ethyl-2-methylpropan-1-amine is sourced from PubChem (CID 79219214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).