C18H19BrO2 — CID 79219231
3-[[4-(bromomethyl)-2,6-dimethylphenoxy]methyl]-2,3-dihydro-1-benzofuran (PubChem CID 79219231) has the molecular formula C18H19BrO2 and a molecular weight of 347.25 g/mol. Its IUPAC name is 3-[[4-(bromomethyl)-2,6-dimethylphenoxy]methyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 3-[[4-(bromomethyl)-2,6-dimethylphenoxy]methyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 79219231 |
| Molecular Formula | C18H19BrO2 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 3-[[4-(bromomethyl)-2,6-dimethylphenoxy]methyl]-2,3-dihydro-1-benzofuran |
| SMILES | Cc1cc(CBr)cc(C)c1OCC1COc2ccccc21 |
| InChI | InChI=1S/C18H19BrO2/c1-12-7-14(9-19)8-13(2)18(12)21-11-15-10-20-17-6-4-3-5-16(15)17/h3-8,15H,9-11H2,1-2H3 |
| InChIKey | KYJHAJVEBOGUIM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|