C27H20N2O2 — CID 7921941
(1S)-3-amino-1-(3-phenylmethoxyphenyl)-1H-benzo[f]chromene-2-carbonitrile (PubChem CID 7921941) has the molecular formula C27H20N2O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is (1S)-3-amino-1-(3-phenylmethoxyphenyl)-1H-benzo[f]chromene-2-carbonitrile.
| Compound Name | (1S)-3-amino-1-(3-phenylmethoxyphenyl)-1H-benzo[f]chromene-2-carbonitrile |
|---|---|
| PubChem CID | 7921941 |
| Molecular Formula | C27H20N2O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (1S)-3-amino-1-(3-phenylmethoxyphenyl)-1H-benzo[f]chromene-2-carbonitrile |
| SMILES | N#CC1=C(N)Oc2ccc3ccccc3c2[C@@H]1c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C27H20N2O2/c28-16-23-25(20-10-6-11-21(15-20)30-17-18-7-2-1-3-8-18)26-22-12-5-4-9-19(22)13-14-24(26)31-27(23)29/h1-15,25H,17,29H2/t25-/m1/s1 |
| InChIKey | OUZXBNYIRCAYQL-RUZDIDTESA-N |
| XLogP | 5.64 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |