About 3-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)-N-ethylpropan-1-amine
3-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)-N-ethylpropan-1-amine (PubChem CID 79219688) has the molecular formula C14H27N3
and a molecular weight of 237.39 g/mol. Its IUPAC name is 3-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)-N-ethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)-N-ethylpropan-1-amine |
| PubChem CID | 79219688 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | 3-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)-N-ethylpropan-1-amine |
| SMILES | CCNCCCc1c(C)nn(C(C)(C)C)c1C |
| InChI | InChI=1S/C14H27N3/c1-7-15-10-8-9-13-11(2)16-17(12(13)3)14(4,5)6/h15H,7-10H2,1-6H3 |
| InChIKey | ZGRQPHWWKSBKBM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)-N-ethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)-N-ethylpropan-1-amine?
The IUPAC name of 3-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)-N-ethylpropan-1-amine (CID 79219688) is 3-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)-N-ethylpropan-1-amine.
What is the SMILES notation for 3-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)-N-ethylpropan-1-amine?
The canonical SMILES for 3-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)-N-ethylpropan-1-amine is CCNCCCc1c(C)nn(C(C)(C)C)c1C.
What is the InChIKey of 3-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)-N-ethylpropan-1-amine?
The InChIKey is ZGRQPHWWKSBKBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N3/c1-7-15-10-8-9-13-11(2)16-17(12(13)3)14(4,5)6/h15H,7-10H2,1-6H3.
What are the key properties of 3-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)-N-ethylpropan-1-amine?
3-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)-N-ethylpropan-1-amine has a molecular weight of 237.39 g/mol, XLogP of 2.80, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)-N-ethylpropan-1-amine is sourced from PubChem (CID 79219688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).