C16H28N4 — CID 79219782
2-(4,6-diethyl-2-pyrrolidin-1-ylpyrimidin-5-yl)-N-ethylethanamine (PubChem CID 79219782) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is 2-(4,6-diethyl-2-pyrrolidin-1-ylpyrimidin-5-yl)-N-ethylethanamine.
| Compound Name | 2-(4,6-diethyl-2-pyrrolidin-1-ylpyrimidin-5-yl)-N-ethylethanamine |
|---|---|
| PubChem CID | 79219782 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 2-(4,6-diethyl-2-pyrrolidin-1-ylpyrimidin-5-yl)-N-ethylethanamine |
| SMILES | CCNCCc1c(CC)nc(N2CCCC2)nc1CC |
| InChI | InChI=1S/C16H28N4/c1-4-14-13(9-10-17-6-3)15(5-2)19-16(18-14)20-11-7-8-12-20/h17H,4-12H2,1-3H3 |
| InChIKey | WQMDKFGVGXKJLY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|