About 3-[4-(2-aminoethyl)-3,5-dimethylpyrazol-1-yl]propanenitrile
3-[4-(2-aminoethyl)-3,5-dimethylpyrazol-1-yl]propanenitrile (PubChem CID 79219987) has the molecular formula C10H16N4
and a molecular weight of 192.27 g/mol. Its IUPAC name is 3-[4-(2-aminoethyl)-3,5-dimethylpyrazol-1-yl]propanenitrile.
Molecular Properties
| Compound Name | 3-[4-(2-aminoethyl)-3,5-dimethylpyrazol-1-yl]propanenitrile |
| PubChem CID | 79219987 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 3-[4-(2-aminoethyl)-3,5-dimethylpyrazol-1-yl]propanenitrile |
| SMILES | Cc1nn(CCC#N)c(C)c1CCN |
| InChI | InChI=1S/C10H16N4/c1-8-10(4-6-12)9(2)14(13-8)7-3-5-11/h3-4,6-7,12H2,1-2H3 |
| InChIKey | LROJLOVNVFYWSO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-(2-aminoethyl)-3,5-dimethylpyrazol-1-yl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2-aminoethyl)-3,5-dimethylpyrazol-1-yl]propanenitrile?
The IUPAC name of 3-[4-(2-aminoethyl)-3,5-dimethylpyrazol-1-yl]propanenitrile (CID 79219987) is 3-[4-(2-aminoethyl)-3,5-dimethylpyrazol-1-yl]propanenitrile.
What is the SMILES notation for 3-[4-(2-aminoethyl)-3,5-dimethylpyrazol-1-yl]propanenitrile?
The canonical SMILES for 3-[4-(2-aminoethyl)-3,5-dimethylpyrazol-1-yl]propanenitrile is Cc1nn(CCC#N)c(C)c1CCN.
What is the InChIKey of 3-[4-(2-aminoethyl)-3,5-dimethylpyrazol-1-yl]propanenitrile?
The InChIKey is LROJLOVNVFYWSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4/c1-8-10(4-6-12)9(2)14(13-8)7-3-5-11/h3-4,6-7,12H2,1-2H3.
What are the key properties of 3-[4-(2-aminoethyl)-3,5-dimethylpyrazol-1-yl]propanenitrile?
3-[4-(2-aminoethyl)-3,5-dimethylpyrazol-1-yl]propanenitrile has a molecular weight of 192.27 g/mol, XLogP of 0.91, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2-aminoethyl)-3,5-dimethylpyrazol-1-yl]propanenitrile is sourced from PubChem (CID 79219987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).