About N-[2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]ethyl]propan-1-amine
N-[2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]ethyl]propan-1-amine (PubChem CID 79220337) has the molecular formula C16H21Cl2N3
and a molecular weight of 326.27 g/mol. Its IUPAC name is N-[2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]ethyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]ethyl]propan-1-amine |
| PubChem CID | 79220337 |
| Molecular Formula | C16H21Cl2N3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-[2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]ethyl]propan-1-amine |
| SMILES | CCCNCCc1c(C)nn(-c2ccc(Cl)cc2Cl)c1C |
| InChI | InChI=1S/C16H21Cl2N3/c1-4-8-19-9-7-14-11(2)20-21(12(14)3)16-6-5-13(17)10-15(16)18/h5-6,10,19H,4,7-9H2,1-3H3 |
| InChIKey | LURBOGUSWUDHFP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]ethyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]ethyl]propan-1-amine?
The IUPAC name of N-[2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]ethyl]propan-1-amine (CID 79220337) is N-[2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]ethyl]propan-1-amine.
What is the SMILES notation for N-[2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]ethyl]propan-1-amine?
The canonical SMILES for N-[2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]ethyl]propan-1-amine is CCCNCCc1c(C)nn(-c2ccc(Cl)cc2Cl)c1C.
What is the InChIKey of N-[2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]ethyl]propan-1-amine?
The InChIKey is LURBOGUSWUDHFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21Cl2N3/c1-4-8-19-9-7-14-11(2)20-21(12(14)3)16-6-5-13(17)10-15(16)18/h5-6,10,19H,4,7-9H2,1-3H3.
What are the key properties of N-[2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]ethyl]propan-1-amine?
N-[2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]ethyl]propan-1-amine has a molecular weight of 326.27 g/mol, XLogP of 4.34, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]ethyl]propan-1-amine is sourced from PubChem (CID 79220337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).