About methyl 2-[1-(4-chlorophenyl)-3,5-diethylpyrazol-4-yl]acetate
methyl 2-[1-(4-chlorophenyl)-3,5-diethylpyrazol-4-yl]acetate (PubChem CID 79220409) has the molecular formula C16H19ClN2O2
and a molecular weight of 306.79 g/mol. Its IUPAC name is methyl 2-[1-(4-chlorophenyl)-3,5-diethylpyrazol-4-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[1-(4-chlorophenyl)-3,5-diethylpyrazol-4-yl]acetate |
| PubChem CID | 79220409 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | methyl 2-[1-(4-chlorophenyl)-3,5-diethylpyrazol-4-yl]acetate |
| SMILES | CCc1nn(-c2ccc(Cl)cc2)c(CC)c1CC(=O)OC |
| InChI | InChI=1S/C16H19ClN2O2/c1-4-14-13(10-16(20)21-3)15(5-2)19(18-14)12-8-6-11(17)7-9-12/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | LMZOSQKTOYIGQD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[1-(4-chlorophenyl)-3,5-diethylpyrazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1-(4-chlorophenyl)-3,5-diethylpyrazol-4-yl]acetate?
The IUPAC name of methyl 2-[1-(4-chlorophenyl)-3,5-diethylpyrazol-4-yl]acetate (CID 79220409) is methyl 2-[1-(4-chlorophenyl)-3,5-diethylpyrazol-4-yl]acetate.
What is the SMILES notation for methyl 2-[1-(4-chlorophenyl)-3,5-diethylpyrazol-4-yl]acetate?
The canonical SMILES for methyl 2-[1-(4-chlorophenyl)-3,5-diethylpyrazol-4-yl]acetate is CCc1nn(-c2ccc(Cl)cc2)c(CC)c1CC(=O)OC.
What is the InChIKey of methyl 2-[1-(4-chlorophenyl)-3,5-diethylpyrazol-4-yl]acetate?
The InChIKey is LMZOSQKTOYIGQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN2O2/c1-4-14-13(10-16(20)21-3)15(5-2)19(18-14)12-8-6-11(17)7-9-12/h6-9H,4-5,10H2,1-3H3.
What are the key properties of methyl 2-[1-(4-chlorophenyl)-3,5-diethylpyrazol-4-yl]acetate?
methyl 2-[1-(4-chlorophenyl)-3,5-diethylpyrazol-4-yl]acetate has a molecular weight of 306.79 g/mol, XLogP of 3.37, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-(4-chlorophenyl)-3,5-diethylpyrazol-4-yl]acetate is sourced from PubChem (CID 79220409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).