2-[1-(2,4-difluorophenyl)-3,5-diethylpyrazol-4-yl]acetic acid

C15H16F2N2O2 — CID 79220410

IUPAC2-[1-(2,4-difluorophenyl)-3,5-diethylpyrazol-4-yl]acetic acid
SMILESCCc1nn(-c2ccc(F)cc2F)c(CC)c1CC(=O)O
InChIInChI=1S/C15H16F2N2O2/c1-3-12-10(8-15(20)21)13(4-2)19(18-12)14-6-5-9(16)7-11(14)17/h5-7H,3-4,8H2,1-2H3,(H,20,21)
InChIKeyLRQJCECDIIAEHO-UHFFFAOYSA-N
MW294.30 g/mol
LogP2.90
Rot. Bonds5

About 2-[1-(2,4-difluorophenyl)-3,5-diethylpyrazol-4-yl]acetic acid

2-[1-(2,4-difluorophenyl)-3,5-diethylpyrazol-4-yl]acetic acid (PubChem CID 79220410) has the molecular formula C15H16F2N2O2 and a molecular weight of 294.30 g/mol. Its IUPAC name is 2-[1-(2,4-difluorophenyl)-3,5-diethylpyrazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[1-(2,4-difluorophenyl)-3,5-diethylpyrazol-4-yl]acetic acid
PubChem CID79220410
Molecular FormulaC15H16F2N2O2
Molecular Weight294.30 g/mol
Exact Mass294.12
IUPAC Name2-[1-(2,4-difluorophenyl)-3,5-diethylpyrazol-4-yl]acetic acid
SMILESCCc1nn(-c2ccc(F)cc2F)c(CC)c1CC(=O)O
InChIInChI=1S/C15H16F2N2O2/c1-3-12-10(8-15(20)21)13(4-2)19(18-12)14-6-5-9(16)7-11(14)17/h5-7H,3-4,8H2,1-2H3,(H,20,21)
InChIKeyLRQJCECDIIAEHO-UHFFFAOYSA-N
XLogP2.90
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.30
LogP ≤ 52.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[1-(2,4-difluorophenyl)-3,5-diethylpyrazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(2,4-difluorophenyl)-3,5-diethylpyrazol-4-yl]acetic acid?
The IUPAC name of 2-[1-(2,4-difluorophenyl)-3,5-diethylpyrazol-4-yl]acetic acid (CID 79220410) is 2-[1-(2,4-difluorophenyl)-3,5-diethylpyrazol-4-yl]acetic acid.
What is the SMILES notation for 2-[1-(2,4-difluorophenyl)-3,5-diethylpyrazol-4-yl]acetic acid?
The canonical SMILES for 2-[1-(2,4-difluorophenyl)-3,5-diethylpyrazol-4-yl]acetic acid is CCc1nn(-c2ccc(F)cc2F)c(CC)c1CC(=O)O.
What is the InChIKey of 2-[1-(2,4-difluorophenyl)-3,5-diethylpyrazol-4-yl]acetic acid?
The InChIKey is LRQJCECDIIAEHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F2N2O2/c1-3-12-10(8-15(20)21)13(4-2)19(18-12)14-6-5-9(16)7-11(14)17/h5-7H,3-4,8H2,1-2H3,(H,20,21).
What are the key properties of 2-[1-(2,4-difluorophenyl)-3,5-diethylpyrazol-4-yl]acetic acid?
2-[1-(2,4-difluorophenyl)-3,5-diethylpyrazol-4-yl]acetic acid has a molecular weight of 294.30 g/mol, XLogP of 2.90, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,4-difluorophenyl)-3,5-diethylpyrazol-4-yl]acetic acid is sourced from PubChem (CID 79220410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).