C13H17NO2 — CID 79220520
3-(2,3-dihydro-1-benzofuran-3-ylmethyl)oxolan-3-amine (PubChem CID 79220520) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-3-ylmethyl)oxolan-3-amine.
| Compound Name | 3-(2,3-dihydro-1-benzofuran-3-ylmethyl)oxolan-3-amine |
|---|---|
| PubChem CID | 79220520 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3-(2,3-dihydro-1-benzofuran-3-ylmethyl)oxolan-3-amine |
| SMILES | NC1(CC2COc3ccccc32)CCOC1 |
| InChI | InChI=1S/C13H17NO2/c14-13(5-6-15-9-13)7-10-8-16-12-4-2-1-3-11(10)12/h1-4,10H,5-9,14H2 |
| InChIKey | WEKCWCGMRQTYOO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |