About [1-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)-4-methylcyclohexyl]methanol
[1-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)-4-methylcyclohexyl]methanol (PubChem CID 79220776) has the molecular formula C17H25NOS
and a molecular weight of 291.46 g/mol. Its IUPAC name is [1-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)-4-methylcyclohexyl]methanol.
Molecular Properties
| Compound Name | [1-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)-4-methylcyclohexyl]methanol |
| PubChem CID | 79220776 |
| Molecular Formula | C17H25NOS |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | [1-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)-4-methylcyclohexyl]methanol |
| SMILES | CC1CCC(CO)(NCC2CSc3ccccc32)CC1 |
| InChI | InChI=1S/C17H25NOS/c1-13-6-8-17(12-19,9-7-13)18-10-14-11-20-16-5-3-2-4-15(14)16/h2-5,13-14,18-19H,6-12H2,1H3 |
| InChIKey | NVMQRPJJDFHANT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)-4-methylcyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)-4-methylcyclohexyl]methanol?
The IUPAC name of [1-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)-4-methylcyclohexyl]methanol (CID 79220776) is [1-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)-4-methylcyclohexyl]methanol.
What is the SMILES notation for [1-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)-4-methylcyclohexyl]methanol?
The canonical SMILES for [1-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)-4-methylcyclohexyl]methanol is CC1CCC(CO)(NCC2CSc3ccccc32)CC1.
What is the InChIKey of [1-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)-4-methylcyclohexyl]methanol?
The InChIKey is NVMQRPJJDFHANT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NOS/c1-13-6-8-17(12-19,9-7-13)18-10-14-11-20-16-5-3-2-4-15(14)16/h2-5,13-14,18-19H,6-12H2,1H3.
What are the key properties of [1-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)-4-methylcyclohexyl]methanol?
[1-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)-4-methylcyclohexyl]methanol has a molecular weight of 291.46 g/mol, XLogP of 3.41, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)-4-methylcyclohexyl]methanol is sourced from PubChem (CID 79220776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).