C27H32N3O2+ — CID 7922114
(2R)-2-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]-N-(2-phenylphenyl)propanamide (PubChem CID 7922114) has the molecular formula C27H32N3O2+ and a molecular weight of 430.57 g/mol. Its IUPAC name is (2R)-2-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]-N-(2-phenylphenyl)propanamide.
| Compound Name | (2R)-2-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]-N-(2-phenylphenyl)propanamide |
|---|---|
| PubChem CID | 7922114 |
| Molecular Formula | C27H32N3O2+ |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | (2R)-2-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]-N-(2-phenylphenyl)propanamide |
| SMILES | CCOc1ccccc1N1CC[NH+]([C@H](C)C(=O)Nc2ccccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C27H31N3O2/c1-3-32-26-16-10-9-15-25(26)30-19-17-29(18-20-30)21(2)27(31)28-24-14-8-7-13-23(24)22-11-5-4-6-12-22/h4-16,21H,3,17-20H2,1-2H3,(H,28,31)/p+1/t21-/m1/s1 |
| InChIKey | RPGHBXFCZCAHEA-OAQYLSRUSA-O |
| XLogP | 3.48 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |