About 4-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,6-difluoroaniline
4-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,6-difluoroaniline (PubChem CID 79221398) has the molecular formula C15H12BrF2NS
and a molecular weight of 356.24 g/mol. Its IUPAC name is 4-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,6-difluoroaniline.
Molecular Properties
| Compound Name | 4-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,6-difluoroaniline |
| PubChem CID | 79221398 |
| Molecular Formula | C15H12BrF2NS |
| Molecular Weight | 356.24 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | 4-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,6-difluoroaniline |
| SMILES | Fc1cc(Br)cc(F)c1NCC1CSc2ccccc21 |
| InChI | InChI=1S/C15H12BrF2NS/c16-10-5-12(17)15(13(18)6-10)19-7-9-8-20-14-4-2-1-3-11(9)14/h1-6,9,19H,7-8H2 |
| InChIKey | AXHNLQLYCFRTGY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.24 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,6-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,6-difluoroaniline?
The IUPAC name of 4-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,6-difluoroaniline (CID 79221398) is 4-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,6-difluoroaniline.
What is the SMILES notation for 4-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,6-difluoroaniline?
The canonical SMILES for 4-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,6-difluoroaniline is Fc1cc(Br)cc(F)c1NCC1CSc2ccccc21.
What is the InChIKey of 4-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,6-difluoroaniline?
The InChIKey is AXHNLQLYCFRTGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrF2NS/c16-10-5-12(17)15(13(18)6-10)19-7-9-8-20-14-4-2-1-3-11(9)14/h1-6,9,19H,7-8H2.
What are the key properties of 4-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,6-difluoroaniline?
4-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,6-difluoroaniline has a molecular weight of 356.24 g/mol, XLogP of 5.03, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,6-difluoroaniline is sourced from PubChem (CID 79221398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).