About N'-(2,3-dihydro-1-benzothiophen-2-ylmethyl)propane-1,3-diamine
N'-(2,3-dihydro-1-benzothiophen-2-ylmethyl)propane-1,3-diamine (PubChem CID 79221945) has the molecular formula C12H18N2S
and a molecular weight of 222.36 g/mol. Its IUPAC name is N'-(2,3-dihydro-1-benzothiophen-2-ylmethyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(2,3-dihydro-1-benzothiophen-2-ylmethyl)propane-1,3-diamine |
| PubChem CID | 79221945 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | N'-(2,3-dihydro-1-benzothiophen-2-ylmethyl)propane-1,3-diamine |
| SMILES | NCCCNCC1Cc2ccccc2S1 |
| InChI | InChI=1S/C12H18N2S/c13-6-3-7-14-9-11-8-10-4-1-2-5-12(10)15-11/h1-2,4-5,11,14H,3,6-9,13H2 |
| InChIKey | WBQVXUNMLHVELK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,3-dihydro-1-benzothiophen-2-ylmethyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,3-dihydro-1-benzothiophen-2-ylmethyl)propane-1,3-diamine?
The IUPAC name of N'-(2,3-dihydro-1-benzothiophen-2-ylmethyl)propane-1,3-diamine (CID 79221945) is N'-(2,3-dihydro-1-benzothiophen-2-ylmethyl)propane-1,3-diamine.
What is the SMILES notation for N'-(2,3-dihydro-1-benzothiophen-2-ylmethyl)propane-1,3-diamine?
The canonical SMILES for N'-(2,3-dihydro-1-benzothiophen-2-ylmethyl)propane-1,3-diamine is NCCCNCC1Cc2ccccc2S1.
What is the InChIKey of N'-(2,3-dihydro-1-benzothiophen-2-ylmethyl)propane-1,3-diamine?
The InChIKey is WBQVXUNMLHVELK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2S/c13-6-3-7-14-9-11-8-10-4-1-2-5-12(10)15-11/h1-2,4-5,11,14H,3,6-9,13H2.
What are the key properties of N'-(2,3-dihydro-1-benzothiophen-2-ylmethyl)propane-1,3-diamine?
N'-(2,3-dihydro-1-benzothiophen-2-ylmethyl)propane-1,3-diamine has a molecular weight of 222.36 g/mol, XLogP of 1.64, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,3-dihydro-1-benzothiophen-2-ylmethyl)propane-1,3-diamine is sourced from PubChem (CID 79221945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).