C17H18O2S — CID 79222447
(1R)-1-[2-(2,3-dihydro-1-benzothiophen-2-ylmethoxy)phenyl]ethanol (PubChem CID 79222447) has the molecular formula C17H18O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is (1R)-1-[2-(2,3-dihydro-1-benzothiophen-2-ylmethoxy)phenyl]ethanol.
| Compound Name | (1R)-1-[2-(2,3-dihydro-1-benzothiophen-2-ylmethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 79222447 |
| Molecular Formula | C17H18O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | (1R)-1-[2-(2,3-dihydro-1-benzothiophen-2-ylmethoxy)phenyl]ethanol |
| SMILES | C[C@@H](O)c1ccccc1OCC1Cc2ccccc2S1 |
| InChI | InChI=1S/C17H18O2S/c1-12(18)15-7-3-4-8-16(15)19-11-14-10-13-6-2-5-9-17(13)20-14/h2-9,12,14,18H,10-11H2,1H3/t12-,14?/m1/s1 |
| InChIKey | DJTWQZOCNLNVMR-PUODRLBUSA-N |
| XLogP | 3.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |